C21H27N5O2 — CID 19143672
ethyl 3-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19143672) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 3-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19143672 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | ethyl 3-[[5-amino-6-[2-(cyclohexen-1-yl)ethylamino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(NCCC3=CCCCC3)c2N)c1 |
| InChI | InChI=1S/C21H27N5O2/c1-2-28-21(27)16-9-6-10-17(13-16)26-20-18(22)19(24-14-25-20)23-12-11-15-7-4-3-5-8-15/h6-7,9-10,13-14H,2-5,8,11-12,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | BJLMLQDCPGGGQY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|