C15H16N4O2 — CID 18375025
ethyl (E)-3-(4-amino-2-anilinopyrimidin-5-yl)prop-2-enoate (PubChem CID 18375025) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is ethyl (E)-3-(4-amino-2-anilinopyrimidin-5-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4-amino-2-anilinopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 18375025 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl (E)-3-(4-amino-2-anilinopyrimidin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(Nc2ccccc2)nc1N |
| InChI | InChI=1S/C15H16N4O2/c1-2-21-13(20)9-8-11-10-17-15(19-14(11)16)18-12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H3,16,17,18,19)/b9-8+ |
| InChIKey | RXWVQRYZQDBJFA-CMDGGOBGSA-N |
| XLogP | 2.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|