C14H14N2O2S — CID 15053530
ethyl (E)-3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoate (PubChem CID 15053530) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is ethyl (E)-3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 15053530 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl (E)-3-(2-anilino-1,3-thiazol-4-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-18-13(17)9-8-12-10-19-14(16-12)15-11-6-4-3-5-7-11/h3-10H,2H2,1H3,(H,15,16)/b9-8+ |
| InChIKey | LUEXVTYUUABBNK-CMDGGOBGSA-N |
| XLogP | 3.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|