C19H26ClN3O2S — CID 175249652
ethyl (E)-3-[2-[[1-(cyclohexylmethyl)pyrrol-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate;hydrochloride (PubChem CID 175249652) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[1-(cyclohexylmethyl)pyrrol-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate;hydrochloride.
| Compound Name | ethyl (E)-3-[2-[[1-(cyclohexylmethyl)pyrrol-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175249652 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl (E)-3-[2-[[1-(cyclohexylmethyl)pyrrol-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate;hydrochloride |
| SMILES | CCOC(=O)/C=C/c1csc(Nc2ccn(CC3CCCCC3)c2)n1.Cl |
| InChI | InChI=1S/C19H25N3O2S.ClH/c1-2-24-18(23)9-8-17-14-25-19(21-17)20-16-10-11-22(13-16)12-15-6-4-3-5-7-15;/h8-11,13-15H,2-7,12H2,1H3,(H,20,21);1H/b9-8+; |
| InChIKey | OPEFWAUAPSXNNC-HRNDJLQDSA-N |
| XLogP | 5.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|