C20H26N2O2S — CID 7753270
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-cyclohexylpropanoate (PubChem CID 7753270) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-cyclohexylpropanoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 7753270 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-cyclohexylpropanoate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)CCC3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-15-7-10-17(11-8-15)21-20-22-18(14-25-20)13-24-19(23)12-9-16-5-3-2-4-6-16/h7-8,10-11,14,16H,2-6,9,12-13H2,1H3,(H,21,22) |
| InChIKey | NVMIUYPFZQWOMJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |