C20H20N2O3S — CID 7841415
[2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-phenoxypropanoate (PubChem CID 7841415) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-phenoxypropanoate.
| Compound Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-phenoxypropanoate |
|---|---|
| PubChem CID | 7841415 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [2-(4-methylanilino)-1,3-thiazol-4-yl]methyl 3-phenoxypropanoate |
| SMILES | Cc1ccc(Nc2nc(COC(=O)CCOc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-15-7-9-16(10-8-15)21-20-22-17(14-26-20)13-25-19(23)11-12-24-18-5-3-2-4-6-18/h2-10,14H,11-13H2,1H3,(H,21,22) |
| InChIKey | ACNXHNFFKAIWCR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |