C17H26N4O2S — CID 87638463
(E)-3-[2-[[(3R)-1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]-N-hydroxyprop-2-enamide (PubChem CID 87638463) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is (E)-3-[2-[[(3R)-1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-[[(3R)-1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87638463 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (E)-3-[2-[[(3R)-1-(cyclohexylmethyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1csc(N[C@@H]2CCN(CC3CCCCC3)C2)n1)NO |
| InChI | InChI=1S/C17H26N4O2S/c22-16(20-23)7-6-15-12-24-17(19-15)18-14-8-9-21(11-14)10-13-4-2-1-3-5-13/h6-7,12-14,23H,1-5,8-11H2,(H,18,19)(H,20,22)/b7-6+/t14-/m1/s1 |
| InChIKey | GLRDBYCJYKZEJZ-PSKZRQQASA-N |
| XLogP | 2.73 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|