C22H34N4O4 — CID 87636807
acetic acid;(E)-3-[6-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 87636807) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is acetic acid;(E)-3-[6-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | acetic acid;(E)-3-[6-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87636807 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | acetic acid;(E)-3-[6-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | CC(=O)O.O=C(/C=C/c1ccc(N[C@@H]2CCCN(CC3CCCCC3)C2)nc1)NO |
| InChI | InChI=1S/C20H30N4O2.C2H4O2/c25-20(23-26)11-9-16-8-10-19(21-13-16)22-18-7-4-12-24(15-18)14-17-5-2-1-3-6-17;1-2(3)4/h8-11,13,17-18,26H,1-7,12,14-15H2,(H,21,22)(H,23,25);1H3,(H,3,4)/b11-9+;/t18-;/m1./s1 |
| InChIKey | SEFWESDILBMCKI-RCMAZSNPSA-N |
| XLogP | 3.15 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|