C20H29N3O2 — CID 68961913
(E)-3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68961913) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (E)-3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68961913 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (E)-3-[6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC2CCN(CC3CCCCC3)CC2)nc1 |
| InChI | InChI=1S/C20H29N3O2/c24-20(25)9-7-16-6-8-19(21-14-16)22-18-10-12-23(13-11-18)15-17-4-2-1-3-5-17/h6-9,14,17-18H,1-5,10-13,15H2,(H,21,22)(H,24,25)/b9-7+ |
| InChIKey | PATGYAHYNCYGAU-VQHVLOKHSA-N |
| XLogP | 3.64 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|