C13H19Cl2N3O2 — CID 68965366
3-[6-(piperidin-4-ylamino)-3-pyridinyl]prop-2-enoic acid;dihydrochloride (PubChem CID 68965366) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 3-[6-(piperidin-4-ylamino)-3-pyridinyl]prop-2-enoic acid;dihydrochloride.
| Compound Name | 3-[6-(piperidin-4-ylamino)-3-pyridinyl]prop-2-enoic acid;dihydrochloride |
|---|---|
| PubChem CID | 68965366 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-[6-(piperidin-4-ylamino)-3-pyridinyl]prop-2-enoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)C=Cc1ccc(NC2CCNCC2)nc1 |
| InChI | InChI=1S/C13H17N3O2.2ClH/c17-13(18)4-2-10-1-3-12(15-9-10)16-11-5-7-14-8-6-11;;/h1-4,9,11,14H,5-8H2,(H,15,16)(H,17,18);2*1H |
| InChIKey | UVVGTDIQWBRWOG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|