C21H24N4O3 — CID 68960336
3-[6-[[1-[(4-methylphenyl)carbamoyl]piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68960336) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-[6-[[1-[(4-methylphenyl)carbamoyl]piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[[1-[(4-methylphenyl)carbamoyl]piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68960336 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-[6-[[1-[(4-methylphenyl)carbamoyl]piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)N2CCC(Nc3ccc(C=CC(=O)O)cn3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-15-2-6-17(7-3-15)24-21(28)25-12-10-18(11-13-25)23-19-8-4-16(14-22-19)5-9-20(26)27/h2-9,14,18H,10-13H2,1H3,(H,22,23)(H,24,28)(H,26,27) |
| InChIKey | LUVQKUJSEJEWSI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|