C20H20ClN3O3 — CID 68960944
3-[6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68960944) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 3-[6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68960944 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-[6-[[1-(4-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NC2CCN(C(=O)c3ccc(Cl)cc3)CC2)nc1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-16-5-3-15(4-6-16)20(27)24-11-9-17(10-12-24)23-18-7-1-14(13-22-18)2-8-19(25)26/h1-8,13,17H,9-12H2,(H,22,23)(H,25,26) |
| InChIKey | KEFWOBMTFZABCN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|