C19H20ClN3O3S — CID 86603624
ethyl (E)-3-[2-[[1-(4-chlorobenzoyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate (PubChem CID 86603624) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[1-(4-chlorobenzoyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[1-(4-chlorobenzoyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 86603624 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | ethyl (E)-3-[2-[[1-(4-chlorobenzoyl)pyrrolidin-3-yl]amino]-1,3-thiazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1csc(NC2CCN(C(=O)c3ccc(Cl)cc3)C2)n1 |
| InChI | InChI=1S/C19H20ClN3O3S/c1-2-26-17(24)8-7-16-12-27-19(22-16)21-15-9-10-23(11-15)18(25)13-3-5-14(20)6-4-13/h3-8,12,15H,2,9-11H2,1H3,(H,21,22)/b8-7+ |
| InChIKey | JROYVGINYPRCME-BQYQJAHWSA-N |
| XLogP | 3.70 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|