C20H28N4O3 — CID 140500490
ethyl (E)-3-[6-[[(3R)-1-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 140500490) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl (E)-3-[6-[[(3R)-1-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[6-[[(3R)-1-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 140500490 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | ethyl (E)-3-[6-[[(3R)-1-(piperidine-1-carbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(N[C@@H]2CCN(C(=O)N3CCCCC3)C2)nc1 |
| InChI | InChI=1S/C20H28N4O3/c1-2-27-19(25)9-7-16-6-8-18(21-14-16)22-17-10-13-24(15-17)20(26)23-11-4-3-5-12-23/h6-9,14,17H,2-5,10-13,15H2,1H3,(H,21,22)/b9-7+/t17-/m1/s1 |
| InChIKey | WNMGRYGBPRTLHI-UGAXZCSASA-N |
| XLogP | 2.75 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|