C21H25N3O4S — CID 90694133
ethyl 3-[6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 90694133) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is ethyl 3-[6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl 3-[6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 90694133 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 3-[6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(N[C@@H]2CCN(S(=O)(=O)c3ccc(C)cc3)C2)nc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-3-28-21(25)11-7-17-6-10-20(22-14-17)23-18-12-13-24(15-18)29(26,27)19-8-4-16(2)5-9-19/h4-11,14,18H,3,12-13,15H2,1-2H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | MIBLPVJQXCMJCT-GOSISDBHSA-N |
| XLogP | 2.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|