C19H20ClN3O4S — CID 68964813
3-[5-chloro-6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68964813) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 3-[5-chloro-6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68964813 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 3-[5-chloro-6-[[(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](Nc3ncc(C=CC(=O)O)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-13-2-5-16(6-3-13)28(26,27)23-9-8-15(12-23)22-19-17(20)10-14(11-21-19)4-7-18(24)25/h2-7,10-11,15H,8-9,12H2,1H3,(H,21,22)(H,24,25)/t15-/m1/s1 |
| InChIKey | RVLRSHZCXZZGME-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|