C21H28ClN3O3 — CID 86603739
ethyl (E)-3-[5-chloro-6-[[(3R)-1-(cyclohexanecarbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 86603739) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is ethyl (E)-3-[5-chloro-6-[[(3R)-1-(cyclohexanecarbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-chloro-6-[[(3R)-1-(cyclohexanecarbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 86603739 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl (E)-3-[5-chloro-6-[[(3R)-1-(cyclohexanecarbonyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(N[C@@H]2CCN(C(=O)C3CCCCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C21H28ClN3O3/c1-2-28-19(26)9-8-15-12-18(22)20(23-13-15)24-17-10-11-25(14-17)21(27)16-6-4-3-5-7-16/h8-9,12-13,16-17H,2-7,10-11,14H2,1H3,(H,23,24)/b9-8+/t17-/m1/s1 |
| InChIKey | QTHGWVWEWXJBCI-KBOKABMXSA-N |
| XLogP | 3.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|