C22H30ClN3O3 — CID 91277565
ethyl 3-[5-chloro-6-[[(3R)-1-(2-cyclohexylacetyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 91277565) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is ethyl 3-[5-chloro-6-[[(3R)-1-(2-cyclohexylacetyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl 3-[5-chloro-6-[[(3R)-1-(2-cyclohexylacetyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 91277565 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | ethyl 3-[5-chloro-6-[[(3R)-1-(2-cyclohexylacetyl)pyrrolidin-3-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnc(N[C@@H]2CCN(C(=O)CC3CCCCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C22H30ClN3O3/c1-2-29-21(28)9-8-17-12-19(23)22(24-14-17)25-18-10-11-26(15-18)20(27)13-16-6-4-3-5-7-16/h8-9,12,14,16,18H,2-7,10-11,13,15H2,1H3,(H,24,25)/t18-/m1/s1 |
| InChIKey | DXTLZIYZFMANEC-GOSISDBHSA-N |
| XLogP | 4.29 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|