C22H23Cl2N3O3 — CID 140500617
ethyl (E)-3-[5-chloro-6-[[1-(3-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 140500617) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is ethyl (E)-3-[5-chloro-6-[[1-(3-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-chloro-6-[[1-(3-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 140500617 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | ethyl (E)-3-[5-chloro-6-[[1-(3-chlorobenzoyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(NC2CCN(C(=O)c3cccc(Cl)c3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-2-30-20(28)7-6-15-12-19(24)21(25-14-15)26-18-8-10-27(11-9-18)22(29)16-4-3-5-17(23)13-16/h3-7,12-14,18H,2,8-11H2,1H3,(H,25,26)/b7-6+ |
| InChIKey | DTYOUAIESCPESZ-VOTSOKGWSA-N |
| XLogP | 4.68 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|