C25H29ClN4O4 — CID 87638015
(E)-3-[5-chloro-6-[[(3R)-1-(3-methylbenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 87638015) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[(3R)-1-(3-methylbenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-6-[[(3R)-1-(3-methylbenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 87638015 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (E)-3-[5-chloro-6-[[(3R)-1-(3-methylbenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | Cc1cccc(C(=O)N2CC[C@@H](Nc3ncc(/C=C/C(=O)NOC4CCCCO4)cc3Cl)C2)c1 |
| InChI | InChI=1S/C25H29ClN4O4/c1-17-5-4-6-19(13-17)25(32)30-11-10-20(16-30)28-24-21(26)14-18(15-27-24)8-9-22(31)29-34-23-7-2-3-12-33-23/h4-6,8-9,13-15,20,23H,2-3,7,10-12,16H2,1H3,(H,27,28)(H,29,31)/b9-8+/t20-,23?/m1/s1 |
| InChIKey | AKSZXBAEFPBMJU-HAPAHAKNSA-N |
| XLogP | 3.96 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|