C22H32ClN3O2 — CID 90728569
ethyl 3-[5-chloro-6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate (PubChem CID 90728569) has the molecular formula C22H32ClN3O2 and a molecular weight of 405.97 g/mol. Its IUPAC name is ethyl 3-[5-chloro-6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate.
| Compound Name | ethyl 3-[5-chloro-6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 90728569 |
| Molecular Formula | C22H32ClN3O2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | ethyl 3-[5-chloro-6-[[1-(cyclohexylmethyl)piperidin-4-yl]amino]-3-pyridinyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cnc(NC2CCN(CC3CCCCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H32ClN3O2/c1-2-28-21(27)9-8-18-14-20(23)22(24-15-18)25-19-10-12-26(13-11-19)16-17-6-4-3-5-7-17/h8-9,14-15,17,19H,2-7,10-13,16H2,1H3,(H,24,25) |
| InChIKey | VTZKHSDAMHZJCD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|