C21H29ClN2O — CID 97456591
(Z)-3-(3-chloro-4-methylphenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]prop-2-enamide (PubChem CID 97456591) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-methylphenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]prop-2-enamide.
| Compound Name | (Z)-3-(3-chloro-4-methylphenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 97456591 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (Z)-3-(3-chloro-4-methylphenyl)-N-[1-(cyclopentylmethyl)piperidin-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C\C(=O)NC2CCN(CC3CCCC3)CC2)cc1Cl |
| InChI | InChI=1S/C21H29ClN2O/c1-16-6-7-17(14-20(16)22)8-9-21(25)23-19-10-12-24(13-11-19)15-18-4-2-3-5-18/h6-9,14,18-19H,2-5,10-13,15H2,1H3,(H,23,25)/b9-8- |
| InChIKey | NLZVRZMJFKEXQL-HJWRWDBZSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|