C26H34Cl2N4O — CID 44533775
(E)-3-(3,4-dichlorophenyl)-N-[4-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide (PubChem CID 44533775) has the molecular formula C26H34Cl2N4O and a molecular weight of 489.49 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[4-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533775 |
| Molecular Formula | C26H34Cl2N4O |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
| SMILES | Cc1n[nH]c(C)c1C1CCN(CC2CCC(NC(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C26H34Cl2N4O/c1-17-26(18(2)31-30-17)21-11-13-32(14-12-21)16-20-3-7-22(8-4-20)29-25(33)10-6-19-5-9-23(27)24(28)15-19/h5-6,9-10,15,20-22H,3-4,7-8,11-14,16H2,1-2H3,(H,29,33)(H,30,31)/b10-6+ |
| InChIKey | GIJSQECAHNFGIP-UXBLZVDNSA-N |
| XLogP | 5.90 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|