C31H38Cl2N4O3S — CID 44534369
N-[3-[1-[[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]methyl]piperidin-4-yl]-2,7-dimethyl-1H-indol-5-yl]methanesulfonamide (PubChem CID 44534369) has the molecular formula C31H38Cl2N4O3S and a molecular weight of 617.64 g/mol. Its IUPAC name is N-[3-[1-[[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]methyl]piperidin-4-yl]-2,7-dimethyl-1H-indol-5-yl]methanesulfonamide.
| Compound Name | N-[3-[1-[[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]methyl]piperidin-4-yl]-2,7-dimethyl-1H-indol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 44534369 |
| Molecular Formula | C31H38Cl2N4O3S |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | N-[3-[1-[[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]methyl]piperidin-4-yl]-2,7-dimethyl-1H-indol-5-yl]methanesulfonamide |
| SMILES | Cc1[nH]c2c(C)cc(NS(C)(=O)=O)cc2c1C1CCN(CC2CCN(C(=O)/C=C/c3ccc(Cl)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C31H38Cl2N4O3S/c1-20-16-25(35-41(3,39)40)18-26-30(21(2)34-31(20)26)24-10-12-36(13-11-24)19-23-8-14-37(15-9-23)29(38)7-5-22-4-6-27(32)28(33)17-22/h4-7,16-18,23-24,34-35H,8-15,19H2,1-3H3/b7-5+ |
| InChIKey | SHFLQCQOKMHDHV-FNORWQNLSA-N |
| XLogP | 6.59 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|