C19H22Cl2N4OS — CID 72689607
3-(3,4-dichlorophenyl)-1-[4-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 72689607) has the molecular formula C19H22Cl2N4OS and a molecular weight of 425.39 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[4-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[4-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72689607 |
| Molecular Formula | C19H22Cl2N4OS |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[4-(4-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)n1c(C2CCN(C(=O)C=Cc3ccc(Cl)c(Cl)c3)CC2)n[nH]c1=S |
| InChI | InChI=1S/C19H22Cl2N4OS/c1-12(2)25-18(22-23-19(25)27)14-7-9-24(10-8-14)17(26)6-4-13-3-5-15(20)16(21)11-13/h3-6,11-12,14H,7-10H2,1-2H3,(H,23,27) |
| InChIKey | VIKOOOOIMACCHI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|