C27H32F2N2O — CID 69172457
(E)-3-(3,5-difluorophenyl)-N-[3-[[4-(4-methylphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide (PubChem CID 69172457) has the molecular formula C27H32F2N2O and a molecular weight of 438.56 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-N-[3-[[4-(4-methylphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-difluorophenyl)-N-[3-[[4-(4-methylphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 69172457 |
| Molecular Formula | C27H32F2N2O |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-N-[3-[[4-(4-methylphenyl)piperidin-1-yl]methyl]cyclopentyl]prop-2-enamide |
| SMILES | Cc1ccc(C2CCN(CC3CCC(NC(=O)/C=C/c4cc(F)cc(F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C27H32F2N2O/c1-19-2-6-22(7-3-19)23-10-12-31(13-11-23)18-21-4-8-26(16-21)30-27(32)9-5-20-14-24(28)17-25(29)15-20/h2-3,5-7,9,14-15,17,21,23,26H,4,8,10-13,16,18H2,1H3,(H,30,32)/b9-5+ |
| InChIKey | HVZBZQOFJLEOLN-WEVVVXLNSA-N |
| XLogP | 5.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|