C28H36N2O — CID 44524823
(E)-N-[4-[4-(2,6-dimethylphenyl)piperidin-1-yl]cyclohexyl]-3-phenylprop-2-enamide (PubChem CID 44524823) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is (E)-N-[4-[4-(2,6-dimethylphenyl)piperidin-1-yl]cyclohexyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[4-(2,6-dimethylphenyl)piperidin-1-yl]cyclohexyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44524823 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (E)-N-[4-[4-(2,6-dimethylphenyl)piperidin-1-yl]cyclohexyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(C)c1C1CCN(C2CCC(NC(=O)/C=C/c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C28H36N2O/c1-21-7-6-8-22(2)28(21)24-17-19-30(20-18-24)26-14-12-25(13-15-26)29-27(31)16-11-23-9-4-3-5-10-23/h3-11,16,24-26H,12-15,17-20H2,1-2H3,(H,29,31)/b16-11+ |
| InChIKey | KIEQDHOGGRRWQH-LFIBNONCSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|