C26H38F3N3O — CID 6622193
N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 6622193) has the molecular formula C26H38F3N3O and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6622193 |
| Molecular Formula | C26H38F3N3O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC1CCCCC1N(C)C1CCN(CCCNC(=O)C=Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H38F3N3O/c1-20-7-3-4-10-24(20)31(2)23-13-17-32(18-14-23)16-6-15-30-25(33)12-11-21-8-5-9-22(19-21)26(27,28)29/h5,8-9,11-12,19-20,23-24H,3-4,6-7,10,13-18H2,1-2H3,(H,30,33) |
| InChIKey | BRZHXABSYVVAHO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|