C25H30ClN3O — CID 69170647
(E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 69170647) has the molecular formula C25H30ClN3O and a molecular weight of 423.99 g/mol. Its IUPAC name is (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 69170647 |
| Molecular Formula | C25H30ClN3O |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (E)-N-[3-[[4-(4-chlorophenyl)piperidin-1-yl]methyl]cyclopentyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccncc1)NC1CCC(CN2CCC(c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C25H30ClN3O/c26-23-5-3-21(4-6-23)22-11-15-29(16-12-22)18-20-1-7-24(17-20)28-25(30)8-2-19-9-13-27-14-10-19/h2-6,8-10,13-14,20,22,24H,1,7,11-12,15-18H2,(H,28,30)/b8-2+ |
| InChIKey | QEZIFIBGHXGIDC-KRXBUXKQSA-N |
| XLogP | 4.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|