C28H33ClN4O — CID 44534307
(E)-3-(2-chlorophenyl)-N-[4-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide (PubChem CID 44534307) has the molecular formula C28H33ClN4O and a molecular weight of 477.05 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534307 |
| Molecular Formula | C28H33ClN4O |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[[4-(1H-pyrrolo[3,2-c]pyridin-3-yl)piperidin-1-yl]methyl]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC1CCC(CN2CCC(c3c[nH]c4ccncc34)CC2)CC1 |
| InChI | InChI=1S/C28H33ClN4O/c29-26-4-2-1-3-22(26)7-10-28(34)32-23-8-5-20(6-9-23)19-33-15-12-21(13-16-33)24-18-31-27-11-14-30-17-25(24)27/h1-4,7,10-11,14,17-18,20-21,23,31H,5-6,8-9,12-13,15-16,19H2,(H,32,34)/b10-7+ |
| InChIKey | KVZRLFGGDQYMDE-JXMROGBWSA-N |
| XLogP | 5.78 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|