C31H36ClN3O — CID 44534127
(E)-3-(2-chlorophenyl)-N-[4-[[(1R,5S)-3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]methyl]cyclohexyl]prop-2-enamide (PubChem CID 44534127) has the molecular formula C31H36ClN3O and a molecular weight of 502.10 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[[(1R,5S)-3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]methyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[[(1R,5S)-3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]methyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534127 |
| Molecular Formula | C31H36ClN3O |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[[(1R,5S)-3-(1H-indol-3-yl)-8-azabicyclo[3.2.1]octan-8-yl]methyl]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC1CCC(CN2[C@@H]3CC[C@H]2CC(c2c[nH]c4ccccc24)C3)CC1 |
| InChI | InChI=1S/C31H36ClN3O/c32-29-7-3-1-5-22(29)11-16-31(36)34-24-12-9-21(10-13-24)20-35-25-14-15-26(35)18-23(17-25)28-19-33-30-8-4-2-6-27(28)30/h1-8,11,16,19,21,23-26,33H,9-10,12-15,17-18,20H2,(H,34,36)/b16-11+/t21?,23?,24?,25-,26+ |
| InChIKey | KYFCABMZNLSYQV-XZNNROLSSA-N |
| XLogP | 6.92 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|