C30H34F3N3O — CID 44533929
(E)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 44533929) has the molecular formula C30H34F3N3O and a molecular weight of 509.62 g/mol. Its IUPAC name is (E)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533929 |
| Molecular Formula | C30H34F3N3O |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | (E)-N-[4-[[4-(1H-indol-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)NC1CCC(CN2CCC(c3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C30H34F3N3O/c31-30(32,33)24-10-5-21(6-11-24)9-14-29(37)35-25-12-7-22(8-13-25)20-36-17-15-23(16-18-36)27-19-34-28-4-2-1-3-26(27)28/h1-6,9-11,14,19,22-23,25,34H,7-8,12-13,15-18,20H2,(H,35,37)/b14-9+ |
| InChIKey | ZLIFTQKDHKJGPZ-NTEUORMPSA-N |
| XLogP | 6.75 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|