C36H37F2N3O3 — CID 145472414
benzyl (2R)-2-[(1R,3S)-3-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]cyclopentyl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]acetate (PubChem CID 145472414) has the molecular formula C36H37F2N3O3 and a molecular weight of 597.71 g/mol. Its IUPAC name is benzyl (2R)-2-[(1R,3S)-3-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]cyclopentyl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]acetate.
| Compound Name | benzyl (2R)-2-[(1R,3S)-3-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]cyclopentyl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 145472414 |
| Molecular Formula | C36H37F2N3O3 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | benzyl (2R)-2-[(1R,3S)-3-[[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]amino]cyclopentyl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]acetate |
| SMILES | O=C(/C=C/c1cc(F)cc(F)c1)N[C@H]1CC[C@@H]([C@H](C(=O)OCc2ccccc2)N2CCC(c3c[nH]c4ccccc34)CC2)C1 |
| InChI | InChI=1S/C36H37F2N3O3/c37-28-18-25(19-29(38)21-28)10-13-34(42)40-30-12-11-27(20-30)35(36(43)44-23-24-6-2-1-3-7-24)41-16-14-26(15-17-41)32-22-39-33-9-5-4-8-31(32)33/h1-10,13,18-19,21-22,26-27,30,35,39H,11-12,14-17,20,23H2,(H,40,42)/b13-10+/t27-,30+,35-/m1/s1 |
| InChIKey | ZEUJZLGWNWWGKD-LFXUFDKASA-N |
| XLogP | 6.74 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|