C26H31N3O3 — CID 55941483
benzyl N-[(2S)-1-[4-(1H-indol-3-yl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 55941483) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[4-(1H-indol-3-yl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[4-(1H-indol-3-yl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55941483 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | benzyl N-[(2S)-1-[4-(1H-indol-3-yl)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H31N3O3/c1-18(2)24(28-26(31)32-17-19-8-4-3-5-9-19)25(30)29-14-12-20(13-15-29)22-16-27-23-11-7-6-10-21(22)23/h3-11,16,18,20,24,27H,12-15,17H2,1-2H3,(H,28,31)/t24-/m0/s1 |
| InChIKey | OTODVWOQSXJBIV-DEOSSOPVSA-N |
| XLogP | 4.82 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |