C21H27N5O3 — CID 51641910
benzyl N-[(2R)-3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate (PubChem CID 51641910) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is benzyl N-[(2R)-3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 51641910 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | benzyl N-[(2R)-3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OCc1ccccc1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-16(2)18(24-21(28)29-15-17-7-4-3-5-8-17)19(27)25-11-13-26(14-12-25)20-22-9-6-10-23-20/h3-10,16,18H,11-15H2,1-2H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | QISDQDICKCQZNS-GOSISDBHSA-N |
| XLogP | 2.08 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |