C18H29N5O3 — CID 110414756
tert-butyl N-[3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate (PubChem CID 110414756) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 110414756 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H29N5O3/c1-13(2)14(21-17(25)26-18(3,4)5)15(24)22-9-11-23(12-10-22)16-19-7-6-8-20-16/h6-8,13-14H,9-12H2,1-5H3,(H,21,25) |
| InChIKey | XKXBCJIMOJXYAL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |