C19H31N5O3 — CID 57169179
tert-butyl N-[4-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)pentan-2-yl]carbamate (PubChem CID 57169179) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 57169179 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl N-[4-methyl-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)pentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H31N5O3/c1-14(2)13-15(22-18(26)27-19(3,4)5)16(25)23-9-11-24(12-10-23)17-20-7-6-8-21-17/h6-8,14-15H,9-13H2,1-5H3,(H,22,26) |
| InChIKey | VBKMWIFXRVLLAR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |