C30H33F3N4O2 — CID 154193945
N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]-2-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]formamide (PubChem CID 154193945) has the molecular formula C30H33F3N4O2 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]-2-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]formamide.
| Compound Name | N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]-2-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]formamide |
|---|---|
| PubChem CID | 154193945 |
| Molecular Formula | C30H33F3N4O2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]-2-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]formamide |
| SMILES | O=CNCC(C1CCN(C(=O)C=Cc2cc(F)c(F)c(F)c2)CC1)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C30H33F3N4O2/c31-25-15-20(16-26(32)30(25)33)5-6-29(39)37-13-9-22(10-14-37)28(18-34-19-38)36-11-7-21(8-12-36)24-17-35-27-4-2-1-3-23(24)27/h1-6,15-17,19,21-22,28,35H,7-14,18H2,(H,34,38) |
| InChIKey | OJJPLEMUHVPFEL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|