C30H36F3N5O3S — CID 23633958
N-[3-[1-[2-amino-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]piperidin-4-yl]-1H-indol-5-yl]methanesulfonamide (PubChem CID 23633958) has the molecular formula C30H36F3N5O3S and a molecular weight of 603.71 g/mol. Its IUPAC name is N-[3-[1-[2-amino-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]piperidin-4-yl]-1H-indol-5-yl]methanesulfonamide.
| Compound Name | N-[3-[1-[2-amino-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]piperidin-4-yl]-1H-indol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 23633958 |
| Molecular Formula | C30H36F3N5O3S |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | N-[3-[1-[2-amino-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]ethyl]piperidin-4-yl]-1H-indol-5-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2[nH]cc(C3CCN(CC(N)C4CCN(C(=O)/C=C/c5cc(F)c(F)c(F)c5)CC4)CC3)c2c1 |
| InChI | InChI=1S/C30H36F3N5O3S/c1-42(40,41)36-22-3-4-28-23(16-22)24(17-35-28)20-6-10-37(11-7-20)18-27(34)21-8-12-38(13-9-21)29(39)5-2-19-14-25(31)30(33)26(32)15-19/h2-5,14-17,20-21,27,35-36H,6-13,18,34H2,1H3/b5-2+ |
| InChIKey | AOCNIUOVKCUURP-GORDUTHDSA-N |
| XLogP | 4.42 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|