C31H34F3N3O4 — CID 58617722
methyl 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetate (PubChem CID 58617722) has the molecular formula C31H34F3N3O4 and a molecular weight of 569.62 g/mol. Its IUPAC name is methyl 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 58617722 |
| Molecular Formula | C31H34F3N3O4 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | methyl 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetate |
| SMILES | COC(=O)C(C1CCN(C(=O)/C=C/c2cc(F)c(F)c(F)c2)CC1)N1CCC(c2c[nH]c3c(OC)cccc23)CC1 |
| InChI | InChI=1S/C31H34F3N3O4/c1-40-26-5-3-4-22-23(18-35-29(22)26)20-8-14-37(15-9-20)30(31(39)41-2)21-10-12-36(13-11-21)27(38)7-6-19-16-24(32)28(34)25(33)17-19/h3-7,16-18,20-21,30,35H,8-15H2,1-2H3/b7-6+ |
| InChIKey | PJLUKMQCEGEBKC-VOTSOKGWSA-N |
| XLogP | 5.27 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|