C29H31F3N4O4 — CID 76839724
2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-1-yl]acetic acid (PubChem CID 76839724) has the molecular formula C29H31F3N4O4 and a molecular weight of 556.59 g/mol. Its IUPAC name is 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 76839724 |
| Molecular Formula | C29H31F3N4O4 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 2-[4-(7-methoxy-1H-indol-3-yl)piperidin-1-yl]-2-[4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-1-yl]acetic acid |
| SMILES | COc1cccc2c(C3CCN(C(C(=O)O)N4CCN(C(=O)C=Cc5cc(F)c(F)c(F)c5)CC4)CC3)c[nH]c12 |
| InChI | InChI=1S/C29H31F3N4O4/c1-40-24-4-2-3-20-21(17-33-27(20)24)19-7-9-35(10-8-19)28(29(38)39)36-13-11-34(12-14-36)25(37)6-5-18-15-22(30)26(32)23(31)16-18/h2-6,15-17,19,28,33H,7-14H2,1H3,(H,38,39) |
| InChIKey | DNIWBEWBKBGSTE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|