C33H39F3N4O4 — CID 69414612
1-[4-hydroxy-4-[1-hydroxy-2-[4-(5-morpholin-4-yl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 69414612) has the molecular formula C33H39F3N4O4 and a molecular weight of 612.69 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[1-hydroxy-2-[4-(5-morpholin-4-yl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-hydroxy-4-[1-hydroxy-2-[4-(5-morpholin-4-yl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69414612 |
| Molecular Formula | C33H39F3N4O4 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 1-[4-hydroxy-4-[1-hydroxy-2-[4-(5-morpholin-4-yl-1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)c(F)c(F)c1)N1CCC(O)(C(O)CN2CCC(c3c[nH]c4ccc(N5CCOCC5)cc34)CC2)CC1 |
| InChI | InChI=1S/C33H39F3N4O4/c34-27-17-22(18-28(35)32(27)36)1-4-31(42)40-11-7-33(43,8-12-40)30(41)21-38-9-5-23(6-10-38)26-20-37-29-3-2-24(19-25(26)29)39-13-15-44-16-14-39/h1-4,17-20,23,30,37,41,43H,5-16,21H2 |
| InChIKey | BMTMZPIBPINIKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|