C28H31F3N4O3 — CID 69414934
1-[4-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-hydroxyethyl]-4-hydroxypiperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 69414934) has the molecular formula C28H31F3N4O3 and a molecular weight of 528.58 g/mol. Its IUPAC name is 1-[4-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-hydroxyethyl]-4-hydroxypiperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-hydroxyethyl]-4-hydroxypiperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69414934 |
| Molecular Formula | C28H31F3N4O3 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 1-[4-[2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-1-hydroxyethyl]-4-hydroxypiperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)c(F)c(F)c1)N1CCC(O)(C(O)CN2CCC(c3nc4ccccc4[nH]3)CC2)CC1 |
| InChI | InChI=1S/C28H31F3N4O3/c29-20-15-18(16-21(30)26(20)31)5-6-25(37)35-13-9-28(38,10-14-35)24(36)17-34-11-7-19(8-12-34)27-32-22-3-1-2-4-23(22)33-27/h1-6,15-16,19,24,36,38H,7-14,17H2,(H,32,33) |
| InChIKey | PDWSXKFNXBRKSP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|