C20H19BrFN3O — CID 146022591
1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-(3-bromo-2-fluorophenyl)ethanone (PubChem CID 146022591) has the molecular formula C20H19BrFN3O and a molecular weight of 416.29 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-(3-bromo-2-fluorophenyl)ethanone.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-(3-bromo-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 146022591 |
| Molecular Formula | C20H19BrFN3O |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-(3-bromo-2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Br)c1F)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H19BrFN3O/c21-15-5-3-4-14(19(15)22)12-18(26)25-10-8-13(9-11-25)20-23-16-6-1-2-7-17(16)24-20/h1-7,13H,8-12H2,(H,23,24) |
| InChIKey | SJDSWOHSAHMCCU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |