C20H21N3OS — CID 35348941
1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-phenylsulfanylethanone (PubChem CID 35348941) has the molecular formula C20H21N3OS and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 35348941 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-phenylsulfanylethanone |
| SMILES | O=C(CSc1ccccc1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H21N3OS/c24-19(14-25-16-6-2-1-3-7-16)23-12-10-15(11-13-23)20-21-17-8-4-5-9-18(17)22-20/h1-9,15H,10-14H2,(H,21,22) |
| InChIKey | DTFWTKYEFSQKGJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |