C27H30F4N2O2 — CID 76839726
1-[4-[1-[4-(4-fluorophenyl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 76839726) has the molecular formula C27H30F4N2O2 and a molecular weight of 490.54 g/mol. Its IUPAC name is 1-[4-[1-[4-(4-fluorophenyl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[1-[4-(4-fluorophenyl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76839726 |
| Molecular Formula | C27H30F4N2O2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[4-[1-[4-(4-fluorophenyl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)c(F)c(F)c1)N1CCC(C(CO)N2CCC(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H30F4N2O2/c28-22-4-2-19(3-5-22)20-7-11-32(12-8-20)25(17-34)21-9-13-33(14-10-21)26(35)6-1-18-15-23(29)27(31)24(30)16-18/h1-6,15-16,20-21,25,34H,7-14,17H2 |
| InChIKey | IWBWXZLOZYEBFZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|