C28H30F3N3O3 — CID 76839729
1-[4-[1-(4-furo[2,3-b]pyridin-3-ylpiperidin-1-yl)-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one (PubChem CID 76839729) has the molecular formula C28H30F3N3O3 and a molecular weight of 513.56 g/mol. Its IUPAC name is 1-[4-[1-(4-furo[2,3-b]pyridin-3-ylpiperidin-1-yl)-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[1-(4-furo[2,3-b]pyridin-3-ylpiperidin-1-yl)-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76839729 |
| Molecular Formula | C28H30F3N3O3 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 1-[4-[1-(4-furo[2,3-b]pyridin-3-ylpiperidin-1-yl)-2-hydroxyethyl]piperidin-1-yl]-3-(3,4,5-trifluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)c(F)c(F)c1)N1CCC(C(CO)N2CCC(c3coc4ncccc34)CC2)CC1 |
| InChI | InChI=1S/C28H30F3N3O3/c29-23-14-18(15-24(30)27(23)31)3-4-26(36)34-12-7-20(8-13-34)25(16-35)33-10-5-19(6-11-33)22-17-37-28-21(22)2-1-9-32-28/h1-4,9,14-15,17,19-20,25,35H,5-8,10-13,16H2 |
| InChIKey | PHSUJPMIAQXJHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|