C26H31F2N3O2 — CID 76839761
3-(3,5-difluorophenyl)-1-[4-[2-hydroxy-1-(4-pyridin-4-ylpiperidin-1-yl)ethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 76839761) has the molecular formula C26H31F2N3O2 and a molecular weight of 455.55 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1-[4-[2-hydroxy-1-(4-pyridin-4-ylpiperidin-1-yl)ethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,5-difluorophenyl)-1-[4-[2-hydroxy-1-(4-pyridin-4-ylpiperidin-1-yl)ethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 76839761 |
| Molecular Formula | C26H31F2N3O2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1-[4-[2-hydroxy-1-(4-pyridin-4-ylpiperidin-1-yl)ethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(F)cc(F)c1)N1CCC(C(CO)N2CCC(c3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C26H31F2N3O2/c27-23-15-19(16-24(28)17-23)1-2-26(33)31-13-7-22(8-14-31)25(18-32)30-11-5-21(6-12-30)20-3-9-29-10-4-20/h1-4,9-10,15-17,21-22,25,32H,5-8,11-14,18H2 |
| InChIKey | SRMMYAJIAQHNTQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|