C24H24F2N4O3 — CID 42407203
(5R)-5-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-5-methyl-3-(pyridin-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 42407203) has the molecular formula C24H24F2N4O3 and a molecular weight of 454.48 g/mol. Its IUPAC name is (5R)-5-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-5-methyl-3-(pyridin-4-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-5-methyl-3-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42407203 |
| Molecular Formula | C24H24F2N4O3 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (5R)-5-[1-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-5-methyl-3-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(C2CCN(C(=O)/C=C/c3cc(F)cc(F)c3)CC2)NC(=O)N(Cc2ccncc2)C1=O |
| InChI | InChI=1S/C24H24F2N4O3/c1-24(22(32)30(23(33)28-24)15-16-4-8-27-9-5-16)18-6-10-29(11-7-18)21(31)3-2-17-12-19(25)14-20(26)13-17/h2-5,8-9,12-14,18H,6-7,10-11,15H2,1H3,(H,28,33)/b3-2+/t24-/m1/s1 |
| InChIKey | ZSUFNUUQQLSDPX-LEFICIQRSA-N |
| XLogP | 3.12 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|