C30H43ClN4O2 — CID 143208489
(Z)-but-2-ene;(E)-3-(3-chlorophenyl)-1-[4-[1-[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 143208489) has the molecular formula C30H43ClN4O2 and a molecular weight of 527.15 g/mol. Its IUPAC name is (Z)-but-2-ene;(E)-3-(3-chlorophenyl)-1-[4-[1-[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-but-2-ene;(E)-3-(3-chlorophenyl)-1-[4-[1-[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 143208489 |
| Molecular Formula | C30H43ClN4O2 |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (Z)-but-2-ene;(E)-3-(3-chlorophenyl)-1-[4-[1-[4-(4,5-dimethyl-1H-imidazol-2-yl)piperidin-1-yl]-2-hydroxyethyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C/C=C\C.Cc1nc(C2CCN(C(CO)C3CCN(C(=O)/C=C/c4cccc(Cl)c4)CC3)CC2)[nH]c1C |
| InChI | InChI=1S/C26H35ClN4O2.C4H8/c1-18-19(2)29-26(28-18)22-10-12-30(13-11-22)24(17-32)21-8-14-31(15-9-21)25(33)7-6-20-4-3-5-23(27)16-20;1-3-4-2/h3-7,16,21-22,24,32H,8-15,17H2,1-2H3,(H,28,29);3-4H,1-2H3/b7-6+;4-3- |
| InChIKey | NDNNJKKPJWGUPD-BMLGIRKESA-N |
| XLogP | 5.75 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|